CAS 1311315-59-9

Cyclohexanamine, 4-methoxy-N-methyl-, hydrochloride (1:1)

Description:

Cyclohexanamine, 4-methoxy-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a methoxy substituent on a cyclohexane ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the methoxy group contributes to its potential biological activity, making it of interest in pharmaceutical research. As a hydrochloride salt, it is often used to improve the stability and handling of the amine compound. The compound's molecular structure suggests it may exhibit properties typical of both amines and aromatic compounds, potentially influencing its reactivity and interaction with biological systems. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₈H₁₇NO·ClH

InChI: InChI=1S/C8H17NO.ClH/c1-9-7-3-5-8(10-2)6-4-7;/h7-9H,3-6H2,1-2H3;1H

InChI key: InChIKey=VSUFVISYKAHGKZ-UHFFFAOYSA-N

SMILES: N(C)C1CCC(OC)CC1.Cl

Synonyms:

• Cyclohexanamine, 4-methoxy-N-methyl-, hydrochloride (1:1)

4-Methoxy-N-methylcyclohexan-1-amine hydrochloride

CAS: 1311315-59-9

Versatile small molecule scaffold

Formula: C₈H₁₈ClNO

Purity: Min. 95%

Molecular weight: 179.69 g/mol

Ref: 3D-LCC31559