CymitQuimica logo

CAS 1311315-70-4

:

1,6-Dihydro-6-methyl-4-phenylpyrazolo[3,4-c]pyrazol-3-amine

Description:
1,6-Dihydro-6-methyl-4-phenylpyrazolo[3,4-c]pyrazol-3-amine is a heterocyclic organic compound characterized by its complex pyrazolo structure, which consists of fused pyrazole rings. This compound features a methyl group and a phenyl group, contributing to its unique chemical properties and potential biological activity. The presence of an amine functional group suggests that it may engage in hydrogen bonding and participate in various chemical reactions, making it a candidate for pharmaceutical applications. Its molecular structure indicates potential for interactions with biological targets, which could be explored in medicinal chemistry. The compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, which are critical for its application in research and development. Overall, 1,6-Dihydro-6-methyl-4-phenylpyrazolo[3,4-c]pyrazol-3-amine represents a class of compounds that may exhibit interesting pharmacological properties, warranting further investigation into its potential uses in drug development.
Formula:C11H11N5
InChI:InChI=1S/C11H11N5/c1-16-11-8(10(12)13-14-11)9(15-16)7-5-3-2-4-6-7/h2-6H,1H3,(H3,12,13,14)
InChI key:InChIKey=WNDPTACAIVLSGH-UHFFFAOYSA-N
SMILES:NC=1C=2C(=NN(C)C2NN1)C3=CC=CC=C3
Synonyms:
  • 1,6-Dihydro-6-methyl-4-phenylpyrazolo[3,4-c]pyrazol-3-amine
  • Pyrazolo[3,4-c]pyrazol-3-amine, 1,6-dihydro-6-methyl-4-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.