CAS 1311315-82-8

2H-Indol-2-one, 3-(2-aminoethyl)-5-ethyl-1,3-dihydro-, hydrochloride (1:1)

Description:

2H-Indol-2-one, 3-(2-aminoethyl)-5-ethyl-1,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific derivative features an aminoethyl side chain and an ethyl group at the 5-position of the indole ring, contributing to its unique properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which typically enhances its solubility in water and stability. The presence of the amino group suggests potential for biological activity, possibly interacting with various biological targets. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could influence its reactivity and interaction with biological systems. As with many indole derivatives, it may exhibit a range of pharmacological effects, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₁₂H₁₆N₂O·ClH

InChI: InChI=1S/C12H16N2O.ClH/c1-2-8-3-4-11-10(7-8)9(5-6-13)12(15)14-11;/h3-4,7,9H,2,5-6,13H2,1H3,(H,14,15);1H

InChI key: InChIKey=RZXBBBSNEBDZGS-UHFFFAOYSA-N

SMILES: C(CN)C1C=2C(NC1=O)=CC=C(CC)C2.Cl

Synonyms:

• 2H-Indol-2-one, 3-(2-aminoethyl)-5-ethyl-1,3-dihydro-, hydrochloride (1:1)

3-(2-Aminoethyl)-5-ethyl-2,3-dihydro-1H-indol-2-one hydrochloride

CAS: 1311315-82-8

Versatile small molecule scaffold

Formula: C₁₂H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 240.73 g/mol

Ref: 3D-LCC31582