CAS 1311315-94-2

[1,1′-Biphenyl]-4-propanoic acid, α-(aminomethyl)-, hydrochloride (1:1)

Description:

[1,1′-Biphenyl]-4-propanoic acid, α-(aminomethyl)-, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a propanoic acid moiety indicates that it has a carboxylic acid functional group, contributing to its acidic properties. The α-(aminomethyl) group suggests that there is an amino group attached to the carbon adjacent to the carboxylic acid, which can participate in hydrogen bonding and enhance solubility in polar solvents. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit biological activity, potentially serving as a pharmaceutical intermediate or active ingredient, depending on its specific interactions within biological systems. Its molecular structure allows for various applications in medicinal chemistry, particularly in the development of drugs targeting specific receptors or pathways. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₆H₁₇NO₂·ClH

InChI: InChI=1S/C16H17NO2.ClH/c17-11-15(16(18)19)10-12-6-8-14(9-7-12)13-4-2-1-3-5-13;/h1-9,15H,10-11,17H2,(H,18,19);1H

InChI key: InChIKey=ZBOGOVTYILOEOB-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)CN)C1=CC=C(C=C1)C2=CC=CC=C2.Cl

Synonyms:

• [1,1′-Biphenyl]-4-propanoic acid, α-(aminomethyl)-, hydrochloride (1:1)