CAS 1311316-24-1

4-Methoxy-3-(methylthio)benzeneacetonitrile

Description:

4-Methoxy-3-(methylthio)benzeneacetonitrile, identified by its CAS number 1311316-24-1, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a methylthio group attached to a benzene ring. This compound features a nitrile functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methoxy group typically enhances the compound's solubility in organic solvents and may influence its electronic properties, while the methylthio group can affect its nucleophilicity and overall stability. The compound is likely to exhibit moderate polarity due to the combination of its functional groups, making it suitable for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex organic molecules. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₁NOS

InChI: InChI=1S/C10H11NOS/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7H,5H2,1-2H3

InChI key: InChIKey=CIYDICDGNXZBIR-UHFFFAOYSA-N

SMILES: S(C)C1=C(OC)C=CC(CC#N)=C1

Synonyms:

• Benzeneacetonitrile, 4-methoxy-3-(methylthio)-
• 4-Methoxy-3-(methylthio)benzeneacetonitrile

2-[4-Methoxy-3-(methylsulfanyl)phenyl]acetonitrile

CAS: 1311316-24-1

Versatile small molecule scaffold

Formula: C₁₀H₁₁NOS

Purity: Min. 95%

Molecular weight: 193.27 g/mol

Ref: 3D-LCC31624