CAS 1311316-26-3

2-(3,4-Difluorophenyl)-4-oxazoleacetic acid

Description:

2-(3,4-Difluorophenyl)-4-oxazoleacetic acid is a chemical compound characterized by its unique structure, which includes an oxazole ring and a difluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the difluorophenyl moiety may enhance lipophilicity and influence the compound's interaction with biological targets. As an oxazole derivative, it may also exhibit acidic properties due to the carboxylic acid functional group, which can participate in hydrogen bonding and ionic interactions. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, where modifications to the phenyl and oxazole components can lead to variations in pharmacological activity. Additionally, its stability and solubility characteristics can be influenced by the presence of the fluorine atoms, which can affect the compound's reactivity and bioavailability. Overall, 2-(3,4-Difluorophenyl)-4-oxazoleacetic acid represents a class of compounds that may have significant implications in pharmaceutical research.

Formula: C₁₁H₇F₂NO₃

InChI: InChI=1S/C11H7F2NO3/c12-8-2-1-6(3-9(8)13)11-14-7(5-17-11)4-10(15)16/h1-3,5H,4H2,(H,15,16)

InChI key: InChIKey=DRCROMDBZGXPTP-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1N=C(OC1)C2=CC(F)=C(F)C=C2

Synonyms:

• 4-Oxazoleacetic acid, 2-(3,4-difluorophenyl)-
• 2-(3,4-Difluorophenyl)-4-oxazoleacetic acid

2-[2-(3,4-Difluorophenyl)-1,3-oxazol-4-yl]acetic acid

CAS: 1311316-26-3

Versatile small molecule scaffold

Formula: C₁₁H₇F₂NO₃

Purity: Min. 95%

Molecular weight: 239.17 g/mol

Ref: 3D-LCC31626