CAS 1311316-27-4

Benzeneethanamine, 3-(cyclopentyloxy)-α-methyl-, hydrochloride (1:1)

Description:

Benzeneethanamine, 3-(cyclopentyloxy)-α-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a cyclopentyloxy substituent. This compound features a benzene ring attached to an ethylamine structure, with a methyl group at the alpha position, which contributes to its steric properties. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. The cyclopentyloxy group introduces a cyclic ether component, which can influence the compound's reactivity and interaction with biological systems. Typically, such compounds may exhibit pharmacological properties, making them of interest in medicinal chemistry. The specific arrangement of atoms and functional groups in this compound can lead to unique chemical behaviors, including potential applications in drug development or as intermediates in organic synthesis. As with many amines, it may also participate in hydrogen bonding, affecting its physical properties such as boiling point and solubility.

Formula: C₁₄H₂₁NO·ClH

InChI: InChI=1S/C14H21NO.ClH/c1-11(15)9-12-5-4-8-14(10-12)16-13-6-2-3-7-13;/h4-5,8,10-11,13H,2-3,6-7,9,15H2,1H3;1H

InChI key: InChIKey=YXZSGEPPGMBELL-UHFFFAOYSA-N

SMILES: O(C1=CC(CC(C)N)=CC=C1)C2CCCC2.Cl

Synonyms:

• Benzeneethanamine, 3-(cyclopentyloxy)-α-methyl-, hydrochloride (1:1)

1-[3-(Cyclopentyloxy)phenyl]propan-2-amine hydrochloride

Controlled Product

CAS: 1311316-27-4

Versatile small molecule scaffold

Formula: C₁₄H₂₂ClNO

Purity: Min. 95%

Molecular weight: 255.78 g/mol

Ref: 3D-LCC31627