CAS 1311316-32-1

1-Methyl-6-oxo-2-[4-(trifluoromethyl)phenyl]-3-piperidinecarboxylic acid

Description:

1-Methyl-6-oxo-2-[4-(trifluoromethyl)phenyl]-3-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring and a trifluoromethyl-substituted phenyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The methyl and keto groups further modify its reactivity and stability. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The specific interactions and mechanisms of action would depend on the compound's conformation and the presence of other functional groups, which can affect its solubility, permeability, and overall pharmacokinetic profile. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₄H₁₄F₃NO₃

InChI: InChI=1S/C14H14F3NO3/c1-18-11(19)7-6-10(13(20)21)12(18)8-2-4-9(5-3-8)14(15,16)17/h2-5,10,12H,6-7H2,1H3,(H,20,21)

InChI key: InChIKey=FPUNJBIWQDUYRP-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C(N(C)C(=O)CC1)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 3-Piperidinecarboxylic acid, 1-methyl-6-oxo-2-[4-(trifluoromethyl)phenyl]-
• 1-Methyl-6-oxo-2-[4-(trifluoromethyl)phenyl]-3-piperidinecarboxylic acid

1-Methyl-6-oxo-2-[4-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid

CAS: 1311316-32-1

Versatile small molecule scaffold

Formula: C₁₄H₁₄F₃NO₃

Purity: Min. 95%

Molecular weight: 301.26 g/mol

Ref: 3D-LCC31632