CAS 1311316-45-6

Piperazine, 1-[(1-phenyl-1H-pyrazol-4-yl)methyl]-, hydrochloride (1:2)

Description:

Piperazine, 1-[(1-phenyl-1H-pyrazol-4-yl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a phenyl group and a pyrazole moiety, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt, enhancing its solubility in water, which is often advantageous for pharmaceutical applications. The presence of the pyrazole ring suggests potential interactions with various biological targets, making it of interest in medicinal chemistry. Its molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the compound's specific stereochemistry and functional groups can affect its reactivity and binding affinity to receptors or enzymes. As with many piperazine derivatives, it may exhibit a range of pharmacological effects, including anxiolytic, antidepressant, or antipsychotic properties, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed due to its classification and potential effects.

Formula: C₁₄H₁₈N₄·2ClH

InChI: InChI=1S/C14H18N4.2ClH/c1-2-4-14(5-3-1)18-12-13(10-16-18)11-17-8-6-15-7-9-17;;/h1-5,10,12,15H,6-9,11H2;2*1H

InChI key: InChIKey=QSUFGHUCTQOLTR-UHFFFAOYSA-N

SMILES: C(C1=CN(N=C1)C2=CC=CC=C2)N3CCNCC3.Cl

Synonyms:

• Piperazine, 1-[(1-phenyl-1H-pyrazol-4-yl)methyl]-, hydrochloride (1:2)

1-[(1-Phenyl-1H-pyrazol-4-yl)methyl]piperazine dihydrochloride

CAS: 1311316-45-6

Versatile small molecule scaffold

Formula: C₁₄H₂₀Cl₂N₄

Purity: Min. 95%

Molecular weight: 315.2 g/mol

Ref: 3D-LCC31645