CymitQuimica logo

CAS 1311316-70-7

:

3-(Chloromethyl)-5-(tetrahydro-4-phenyl-2H-pyran-4-yl)-1,2,4-oxadiazole

Description:
3-(Chloromethyl)-5-(tetrahydro-4-phenyl-2H-pyran-4-yl)-1,2,4-oxadiazole is a chemical compound characterized by its unique structure, which includes an oxadiazole ring and a tetrahydro-4-phenyl-2H-pyran moiety. The presence of the chloromethyl group suggests potential reactivity, making it a candidate for further chemical transformations. This compound may exhibit interesting biological activities due to its heterocyclic nature, which is often associated with pharmacological properties. The oxadiazole ring is known for its stability and ability to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the tetrahydro-4-phenyl-2H-pyran component may contribute to the compound's lipophilicity and potential interactions with biological targets. Overall, this compound's characteristics, including its molecular structure and functional groups, position it as a subject of interest in medicinal chemistry and material science, although specific applications and biological activities would require further investigation.
Formula:C14H15ClN2O2
InChI:InChI=1S/C14H15ClN2O2/c15-10-12-16-13(19-17-12)14(6-8-18-9-7-14)11-4-2-1-3-5-11/h1-5H,6-10H2
InChI key:InChIKey=JZLOYIOHWZTAPJ-UHFFFAOYSA-N
SMILES:C(Cl)C=1N=C(C2(CCOCC2)C3=CC=CC=C3)ON1
Synonyms:
  • 1,2,4-Oxadiazole, 3-(chloromethyl)-5-(tetrahydro-4-phenyl-2H-pyran-4-yl)-
  • 3-(Chloromethyl)-5-(tetrahydro-4-phenyl-2H-pyran-4-yl)-1,2,4-oxadiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.