CAS 1311316-86-5

Piperazine, 1-(2-bromoethyl)-4-(1-methylethyl)-, hydrobromide (1:1)

Description:

Piperazine, 1-(2-bromoethyl)-4-(1-methylethyl)-, hydrobromide (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a bromoethyl group and an isopropyl substituent on the piperazine ring contributes to its unique reactivity and potential biological activity. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as antimicrobial or anti-parasitic activity, which is common among piperazine derivatives. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as halogenated compounds can pose health risks. Overall, this compound represents a specific class of piperazine derivatives with potential applications in drug development and research.

Formula: C₉H₁₉BrN₂·BrH

InChI: InChI=1S/C9H19BrN2.BrH/c1-9(2)12-7-5-11(4-3-10)6-8-12;/h9H,3-8H2,1-2H3;1H

InChI key: InChIKey=HRVYQGNLYBRWJK-UHFFFAOYSA-N

SMILES: C(C)(C)N1CCN(CCBr)CC1.Br

Synonyms:

• Piperazine, 1-(2-bromoethyl)-4-(1-methylethyl)-, hydrobromide (1:1)