CAS 1311317-06-2

2-(1H-Pyrazol-1-ylmethyl)morpholine

Description:

2-(1H-Pyrazol-1-ylmethyl)morpholine is a chemical compound characterized by its unique structure, which includes a morpholine ring and a pyrazole moiety. The morpholine part contributes to its potential as a heterocyclic compound, often exhibiting properties such as good solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of nitrogen atoms. The pyrazole ring, known for its biological activity, can enhance the compound's reactivity and interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas requiring compounds with specific binding affinities or biological activities. Additionally, the presence of both morpholine and pyrazole groups may influence its lipophilicity and overall stability, which are critical factors in the design of effective pharmaceuticals. As with many organic compounds, its behavior in different environments, including reactivity and stability, can be influenced by factors such as pH, temperature, and the presence of other chemical species.

Formula: C₈H₁₃N₃O

InChI: InChI=1S/C8H13N3O/c1-2-10-11(4-1)7-8-6-9-3-5-12-8/h1-2,4,8-9H,3,5-7H2

InChI key: InChIKey=LWBBFLJNOWLMTE-UHFFFAOYSA-N

SMILES: C(C1CNCCO1)N2C=CC=N2

Synonyms:

• 2-(1H-Pyrazol-1-ylmethyl)morpholine
• Morpholine, 2-(1H-pyrazol-1-ylmethyl)-

2-[(1H-Pyrazol-1-yl)methyl]morpholine

CAS: 1311317-06-2

Versatile small molecule scaffold

Formula: C₈H₁₃N₃O

Purity: Min. 95%

Molecular weight: 167.21 g/mol

Ref: 3D-LCC31706