CAS 1311317-07-3

5-Ethyl-4-methyl-4H-1,2,4-triazole-3-methanol

Description:

5-Ethyl-4-methyl-4H-1,2,4-triazole-3-methanol is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an ethyl group and a methyl group attached to the triazole ring, contributing to its unique properties. The presence of a hydroxymethyl group (-CH2OH) at the 3-position enhances its solubility in polar solvents and may influence its reactivity and biological activity. Compounds of this type are often studied for their potential applications in agriculture, particularly as fungicides or herbicides, due to their ability to inhibit specific biochemical pathways in target organisms. Additionally, the structural modifications provided by the ethyl and methyl groups can affect the compound's lipophilicity and overall pharmacokinetic properties. As with many nitrogen-containing heterocycles, 5-Ethyl-4-methyl-4H-1,2,4-triazole-3-methanol may exhibit interesting interactions with biological systems, making it a subject of interest in medicinal chemistry and agrochemical research.

Formula: C₆H₁₁N₃O

InChI: InChI=1S/C6H11N3O/c1-3-5-7-8-6(4-10)9(5)2/h10H,3-4H2,1-2H3

InChI key: InChIKey=YQAGDVIEWLZWRJ-UHFFFAOYSA-N

SMILES: C(C)C=1N(C)C(CO)=NN1

Synonyms:

• 4H-1,2,4-Triazole-3-methanol, 5-ethyl-4-methyl-
• 5-Ethyl-4-methyl-4H-1,2,4-triazole-3-methanol

(5-Ethyl-4-methyl-4H-1,2,4-triazol-3-yl)methanol

CAS: 1311317-07-3

Versatile small molecule scaffold

Formula: C₆H₁₁N₃O

Purity: Min. 95%

Molecular weight: 141.17 g/mol

Ref: 3D-LCC31707