CAS 1311317-18-6
:α-4-Pyridinyl-4-pyridinepropanenitrile
Description:
α-4-Pyridinyl-4-pyridinepropanenitrile, identified by its CAS number 1311317-18-6, is a chemical compound that features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound is characterized by its nitrile functional group (-C≡N) attached to a propanamine structure, which contributes to its potential biological activity. Pyridine derivatives are often studied for their pharmacological properties, including antimicrobial, anti-inflammatory, and anticancer activities. The presence of multiple pyridine rings in this compound may enhance its ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by the electronic properties of the pyridine rings and the nitrile group. Overall, α-4-Pyridinyl-4-pyridinepropanenitrile represents a class of compounds that may have significant applications in drug development and other chemical research areas.
Formula:C13H11N3
InChI:InChI=1S/C13H11N3/c14-10-13(12-3-7-16-8-4-12)9-11-1-5-15-6-2-11/h1-8,13H,9H2
InChI key:InChIKey=OESHQDCDDFSLDN-UHFFFAOYSA-N
SMILES:C(CC=1C=CN=CC1)(C#N)C=2C=CN=CC2
Synonyms:- α-4-Pyridinyl-4-pyridinepropanenitrile
- 4-Pyridinepropanenitrile, α-4-pyridinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.