CAS 1311317-32-4

5-Methyl-3-isoxazolemethanesulfonyl fluoride

Description:

5-Methyl-3-isoxazolemethanesulfonyl fluoride is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its reactivity and potential applications in various fields, including medicinal chemistry and biochemistry. The presence of a sulfonyl fluoride group enhances its electrophilic properties, making it a useful reagent for the modification of biomolecules, particularly in the synthesis of sulfonamide derivatives. This compound is typically a solid at room temperature and may exhibit moderate to high solubility in polar organic solvents. Its reactivity can be attributed to the sulfonyl fluoride moiety, which can participate in nucleophilic substitution reactions. Additionally, the methyl group at the 5-position of the isoxazole ring can influence the compound's steric and electronic properties, potentially affecting its biological activity. Safety precautions should be taken when handling this compound, as sulfonyl fluorides can be hazardous and may require specific storage conditions to maintain stability. Overall, 5-Methyl-3-isoxazolemethanesulfonyl fluoride is a versatile compound with significant implications in chemical synthesis and research.

Formula: C₅H₆FNO₃S

InChI: InChI=1S/C5H6FNO3S/c1-4-2-5(7-10-4)3-11(6,8)9/h2H,3H2,1H3

InChI key: InChIKey=DXOWYDLFFKYMOF-UHFFFAOYSA-N

SMILES: C(S(F)(=O)=O)C1=NOC(C)=C1

Synonyms:

• 5-Methyl-3-isoxazolemethanesulfonyl fluoride
• 3-Isoxazolemethanesulfonyl fluoride, 5-methyl-

(5-Methyl-1,2-oxazol-3-yl)methanesulfonyl fluoride

CAS: 1311317-32-4

Versatile small molecule scaffold

Formula: C₅H₆FNO₃S

Purity: Min. 95%

Molecular weight: 179.17 g/mol

Ref: 3D-LCC31732