CAS 1311317-36-8

Cyclobutanecarboxamide, N-(3-aminocyclobutyl)-, hydrochloride (1:1)

Description:

Cyclobutanecarboxamide, N-(3-aminocyclobutyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes a cyclobutane ring and an amine functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The amine group contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders, given the structural motifs often associated with bioactive compounds. The compound's properties, such as melting point, boiling point, and specific reactivity, would depend on its purity and the conditions under which it is handled. As with many amides, it may exhibit hydrogen bonding capabilities, influencing its interactions in biological systems. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₁₆N₂O·ClH

InChI: InChI=1S/C9H16N2O.ClH/c10-7-4-8(5-7)11-9(12)6-2-1-3-6;/h6-8H,1-5,10H2,(H,11,12);1H

InChI key: InChIKey=CVHZNTLBWCZMSL-UHFFFAOYSA-N

SMILES: C(NC1CC(N)C1)(=O)C2CCC2.Cl

Synonyms:

• Cyclobutanecarboxamide, N-(3-aminocyclobutyl)-, hydrochloride (1:1)