CymitQuimica logo

CAS 1311317-43-7

:

Piperidine, 2-(5-methyl-1,2,4-oxadiazol-3-yl)-, hydrochloride (1:2)

Description:
Piperidine, 2-(5-methyl-1,2,4-oxadiazol-3-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 5-methyl-1,2,4-oxadiazole substituent, which contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the oxadiazole moiety may impart specific pharmacological effects, making it of interest in medicinal chemistry. The compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling considerations are essential, as with any chemical substance, particularly in laboratory settings. Overall, this compound exemplifies the diverse chemistry of nitrogen-containing heterocycles and their derivatives.
Formula:C8H13N3O·2ClH
InChI:InChI=1S/C8H13N3O.2ClH/c1-6-10-8(11-12-6)7-4-2-3-5-9-7;;/h7,9H,2-5H2,1H3;2*1H
InChI key:InChIKey=HNHSURUJLDUZGS-UHFFFAOYSA-N
SMILES:CC1=NC(=NO1)C2CCCCN2.Cl
Synonyms:
  • Piperidine, 2-(5-methyl-1,2,4-oxadiazol-3-yl)-, hydrochloride (1:2)
Found 1 products.