CAS 1311317-55-1

Cyclopropanamine, 2-(2,6-difluorophenyl)-, hydrochloride (1:1)

Description:

Cyclopropanamine, 2-(2,6-difluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane structure, which is a three-membered carbon ring, and an amine functional group. The presence of a 2,6-difluorophenyl group indicates that the compound has two fluorine atoms substituted on a phenyl ring at the 2 and 6 positions, which can significantly influence its chemical properties and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit interesting pharmacological properties due to the combination of the cyclopropanamine structure and the difluorophenyl substituent, potentially affecting its interaction with biological targets. Its CAS number, 1311317-55-1, allows for easy identification in chemical databases. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, although specific biological activities and safety profiles would require further investigation.

Formula: C₉H₉F₂N·ClH

InChI: InChI=1S/C9H9F2N.ClH/c10-6-2-1-3-7(11)9(6)5-4-8(5)12;/h1-3,5,8H,4,12H2;1H

InChI key: InChIKey=CPHGOKICURNLKE-UHFFFAOYSA-N

SMILES: FC1=C(C(F)=CC=C1)C2C(N)C2.Cl

Synonyms:

• Cyclopropanamine, 2-(2,6-difluorophenyl)-, hydrochloride (1:1)