CymitQuimica logo

CAS 1311317-66-4

:

3-(Aminomethyl)octahydro-6-methyl-2(1H)-quinolinone

Description:
3-(Aminomethyl)octahydro-6-methyl-2(1H)-quinolinone, identified by its CAS number 1311317-66-4, is a chemical compound that belongs to the class of quinolinones, which are bicyclic compounds featuring a quinoline structure fused with a lactam. This specific compound exhibits a complex molecular structure characterized by a saturated octahydro framework, which contributes to its potential biological activity. The presence of an aminomethyl group enhances its reactivity and may influence its interaction with biological targets. The methyl group at the 6-position of the quinolinone ring can affect the compound's lipophilicity and overall pharmacokinetic properties. Such compounds are often investigated for their potential therapeutic applications, including antimicrobial and anti-inflammatory activities. The structural features of 3-(aminomethyl)octahydro-6-methyl-2(1H)-quinolinone suggest that it may participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H20N2O
InChI:InChI=1S/C11H20N2O/c1-7-2-3-10-8(4-7)5-9(6-12)11(14)13-10/h7-10H,2-6,12H2,1H3,(H,13,14)
InChI key:InChIKey=NQJRCGSIQBCYRW-UHFFFAOYSA-N
SMILES:C(N)C1CC2C(NC1=O)CCC(C)C2
Synonyms:
  • 2(1H)-Quinolinone, 3-(aminomethyl)octahydro-6-methyl-
  • 3-(Aminomethyl)octahydro-6-methyl-2(1H)-quinolinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.