CAS 1311317-68-6

Isoquinoline, 7-fluoro-1,2,3,4-tetrahydro-1-methyl-, hydrochloride (1:1)

Description:

Isoquinoline, 7-fluoro-1,2,3,4-tetrahydro-1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline backbone, which is a bicyclic structure containing a fused benzene and pyridine ring. The presence of a fluorine atom at the 7-position and a methyl group at the 1-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the tetrahydro configuration indicates that the compound is saturated at certain positions, influencing its reactivity and stability. Overall, the characteristics of this compound make it a subject of interest for further research in drug development and chemical synthesis.

Formula: C₁₀H₁₂FN·ClH

InChI: InChI=1S/C10H12FN.ClH/c1-7-10-6-9(11)3-2-8(10)4-5-12-7;/h2-3,6-7,12H,4-5H2,1H3;1H

InChI key: InChIKey=LBLPHVVQYMPIHT-UHFFFAOYSA-N

SMILES: CC1C=2C(=CC=C(F)C2)CCN1.Cl

Synonyms:

• Isoquinoline, 7-fluoro-1,2,3,4-tetrahydro-1-methyl-, hydrochloride (1:1)

7-Fluoro-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride

CAS: 1311317-68-6

Versatile small molecule scaffold

Formula: C₁₀H₁₃ClFN

Purity: Min. 95%

Molecular weight: 201.67 g/mol

Ref: 3D-LCC31768