CAS 1311317-71-1

3-[[(2-Chloroacetyl)amino]methyl]-N-cyclopropylbenzamide

Description:

3-[[(2-Chloroacetyl)amino]methyl]-N-cyclopropylbenzamide is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with a cyclopropyl group and a 2-chloroacetylamino side chain. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the chloroacetyl group, which can participate in nucleophilic substitution reactions. The cyclopropyl moiety may influence the compound's steric and electronic properties, potentially affecting its biological activity and interaction with target proteins. Additionally, the presence of the chloroacetyl group suggests that this compound may have applications in medicinal chemistry, possibly as an intermediate in the synthesis of pharmaceuticals or as a bioactive agent. Its specific characteristics, including melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases for precise values. Overall, this compound represents a unique structure that may be of interest in various chemical and biological research contexts.

Formula: C₁₃H₁₅ClN₂O₂

InChI: InChI=1S/C13H15ClN2O2/c14-7-12(17)15-8-9-2-1-3-10(6-9)13(18)16-11-4-5-11/h1-3,6,11H,4-5,7-8H2,(H,15,17)(H,16,18)

InChI key: InChIKey=ODHMLJGWBMAUKE-UHFFFAOYSA-N

SMILES: C(NC1CC1)(=O)C2=CC(CNC(CCl)=O)=CC=C2

Synonyms:

• Benzamide, 3-[[(2-chloroacetyl)amino]methyl]-N-cyclopropyl-
• 3-[[(2-Chloroacetyl)amino]methyl]-N-cyclopropylbenzamide

3-[(2-Chloroacetamido)methyl]-N-cyclopropylbenzamide

CAS: 1311317-71-1

Versatile small molecule scaffold

Formula: C₁₃H₁₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 266.72 g/mol

Ref: 3D-LCC31771