
CAS 1311317-80-2
:4-Pyridinemethanamine, α-2-benzofuranyl-, hydrochloride (1:2)
Description:
4-Pyridinemethanamine, α-2-benzofuranyl-, hydrochloride (1:2) is a chemical compound characterized by its unique structure, which includes a pyridine ring and a benzofuran moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride indicates that it is a salt form, which often enhances its stability and solubility. In terms of biological activity, compounds of this nature may exhibit pharmacological properties, potentially influencing neurotransmitter systems or serving as intermediates in the synthesis of more complex molecules. Its molecular interactions can be influenced by the functional groups present, which may affect its reactivity and binding affinity in biological systems. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the specific effects and safety profiles can vary based on concentration and exposure routes.
Formula:C14H12N2O·2ClH
InChI:InChI=1S/C14H12N2O.2ClH/c15-14(10-5-7-16-8-6-10)13-9-11-3-1-2-4-12(11)17-13;;/h1-9,14H,15H2;2*1H
InChI key:InChIKey=RBFSSKBMSWQVEA-UHFFFAOYSA-N
SMILES:C(N)(C1=CC=2C(O1)=CC=CC2)C=3C=CN=CC3.Cl
Synonyms:- 4-Pyridinemethanamine, α-2-benzofuranyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.