CymitQuimica logo

CAS 1311317-88-0

:

8-Bromo-2H-1-benzopyran-6-acetonitrile

Description:
8-Bromo-2H-1-benzopyran-6-acetonitrile is a chemical compound characterized by its unique structure, which includes a benzopyran moiety substituted with a bromine atom and an acetonitrile group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the bromine substituent. The benzopyran structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity. The presence of the acetonitrile group can influence its solubility and polarity, making it suitable for various organic synthesis reactions. Additionally, the bromine atom can serve as a site for further chemical modifications, enhancing its utility in synthetic pathways. Overall, 8-Bromo-2H-1-benzopyran-6-acetonitrile is a versatile compound with potential applications in research and industry, particularly in the fields of organic synthesis and drug development.
Formula:C11H8BrNO
InChI:InChI=1S/C11H8BrNO/c12-10-7-8(3-4-13)6-9-2-1-5-14-11(9)10/h1-2,6-7H,3,5H2
InChI key:InChIKey=SWAUJJXVWQQWRG-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(CC#N)=C1)C=CCO2
Synonyms:
  • 2H-1-Benzopyran-6-acetonitrile, 8-bromo-
  • 8-Bromo-2H-1-benzopyran-6-acetonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.