CAS 1311317-97-1

Imidazo[1,2-a]pyridine-2-carboxaldehyde, 3-bromo-, hydrobromide (1:1)

Description:

Imidazo[1,2-a]pyridine-2-carboxaldehyde, 3-bromo-, hydrobromide (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which incorporates both a pyridine and an imidazole ring. This compound features a carboxaldehyde functional group at the 2-position and a bromine atom at the 3-position of the imidazo ring, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The hydrobromide salt form indicates that it is combined with hydrobromic acid, enhancing its solubility in polar solvents and potentially influencing its biological activity. The presence of the bromine atom may also impart unique electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may be of interest in the development of pharmaceuticals, particularly in the search for new therapeutic agents, due to the biological significance of imidazo-pyridine derivatives. As with many such compounds, safety and handling precautions should be observed, given the potential hazards associated with brominated compounds and aldehydes.

Formula: C₈H₅BrN₂O·BrH

InChI: InChI=1S/C8H5BrN2O.BrH/c9-8-6(5-12)10-7-3-1-2-4-11(7)8;/h1-5H;1H

InChI key: InChIKey=JJGIYDFJHCEWIR-UHFFFAOYSA-N

SMILES: BrC=1N2C(=NC1C=O)C=CC=C2.Br

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxaldehyde, 3-bromo-, hydrobromide (1:1)

3-Bromoimidazo[1,2-a]pyridine-2-carbaldehyde hydrobromide

CAS: 1311317-97-1

Versatile small molecule scaffold

Formula: C₈H₆Br₂N₂O

Purity: Min. 95%

Molecular weight: 305.95 g/mol

Ref: 3D-LCC31797