CAS 1311318-17-8

1H-Tetrazole-1-ethanamine, 5-methyl-, hydrochloride (1:2)

Description:

1H-Tetrazole-1-ethanamine, 5-methyl-, hydrochloride (1:2) is a chemical compound characterized by its tetrazole ring structure, which is a five-membered aromatic ring containing four nitrogen atoms and one carbon atom. This compound features an ethylamine side chain and a methyl group at the 5-position of the tetrazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the tetrazole moiety often imparts biological activity, making it of interest in medicinal chemistry for potential therapeutic uses. The compound may exhibit properties such as being a weak base due to the amine group, and it can participate in hydrogen bonding due to the presence of nitrogen atoms. Its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.

Formula: C₄H₉N₅·2ClH

InChI: InChI=1S/C4H9N5.2ClH/c1-4-6-7-8-9(4)3-2-5;;/h2-3,5H2,1H3;2*1H

InChI key: InChIKey=QXLSHUALERKMJO-UHFFFAOYSA-N

SMILES: C(CN)N1C(C)=NN=N1.Cl

Synonyms:

• 1H-Tetrazole-1-ethanamine, 5-methyl-, hydrochloride (1:2)

2-(5-Methyl-1H-1,2,3,4-tetrazol-1-yl)ethan-1-amine dihydrochloride

CAS: 1311318-17-8

Versatile small molecule scaffold

Formula: C₄H₁₁Cl₂N₅

Purity: Min. 95%

Molecular weight: 200.07 g/mol

Ref: 3D-LCC31817