
CAS 1311318-40-7
:4-Piperidinesulfonamide, 1-methyl-, hydrochloride (1:1)
Description:
4-Piperidinesulfonamide, 1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a sulfonamide group contributes to its potential biological activity, often associated with antibacterial properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in pharmaceutical applications. The compound's molecular structure includes a methyl group attached to the nitrogen of the piperidine, which can influence its pharmacokinetic properties. This substance may exhibit various characteristics such as moderate to high polarity, making it suitable for interactions with biological targets. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, 4-Piperidinesulfonamide, 1-methyl-, hydrochloride is of interest in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C6H14N2O2S·ClH
InChI:InChI=1S/C6H14N2O2S.ClH/c1-8-4-2-6(3-5-8)11(7,9)10;/h6H,2-5H2,1H3,(H2,7,9,10);1H
InChI key:InChIKey=XFSKMFZTYBBNKS-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1CCN(C)CC1.Cl
Synonyms:- 4-Piperidinesulfonamide, 1-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.