CAS 131132-77-9

1,5-Bis[[4-[(ethenyloxy)methyl]cyclohexyl]methyl] pentanedioate

Description:

1,5-Bis[[4-[(ethenyloxy)methyl]cyclohexyl]methyl]pentanedioate, identified by its CAS number 131132-77-9, is a chemical compound characterized by its complex structure that includes multiple functional groups. It features a pentanedioate backbone, which is a dicarboxylic acid derivative, and is substituted with cyclohexyl groups that are further modified with ethenyloxy methyl groups. This structure contributes to its potential applications in polymer chemistry, particularly in the synthesis of crosslinking agents or as a monomer in the production of specialty polymers. The presence of the ethenyloxy groups suggests reactivity that can be exploited in various polymerization processes, making it valuable in materials science. Additionally, the cyclohexyl moieties may impart unique physical properties, such as increased rigidity or thermal stability, depending on the overall molecular arrangement. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory or industrial settings.

Formula: C₂₅H₄₀O₆

InChI: InChI=1S/C25H40O6/c1-3-28-16-20-8-12-22(13-9-20)18-30-24(26)6-5-7-25(27)31-19-23-14-10-21(11-15-23)17-29-4-2/h3-4,20-23H,1-2,5-19H2

InChI key: InChIKey=SDNBHBGJJPWRJG-UHFFFAOYSA-N

SMILES: C(OC(CCCC(OCC1CCC(COC=C)CC1)=O)=O)C2CCC(COC=C)CC2

Synonyms:

• Pentanedioic acid, bis[[4-[(ethenyloxy)methyl]cyclohexyl]methyl] ester
• VEctomer 4020
• Pentanedioic acid, 1,5-bis[[4-[(ethenyloxy)methyl]cyclohexyl]methyl] ester
• 1,5-Bis[[4-[(ethenyloxy)methyl]cyclohexyl]methyl] pentanedioate

Pentanedioic acid, 1,5-bis[[4-[(ethenyloxy)methyl]cyclohexyl]methyl] ester

CAS: 131132-77-9

Formula: C₂₅H₄₀O₆

Molecular weight: 436.5815

Ref: IN-DA000VLJ