CAS 13114-22-2
:N-[(4-CHLOROPHENYL)METHYLENE]METHANAMINE
Description:
N-[(4-Chlorophenyl)methylene]methanamine, with the CAS number 13114-22-2, is an organic compound characterized by its structure, which features a methanamine backbone substituted with a 4-chlorobenzylidene group. This compound typically appears as a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the chlorophenyl group may impart specific biological activities, making it of interest in medicinal chemistry. Its reactivity can be influenced by the functional groups present, allowing for potential interactions in biological systems. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions. Safety data sheets would provide essential information regarding its handling, storage, and potential hazards, as with many amines, it may exhibit toxicity or irritant properties. Overall, N-[(4-chlorophenyl)methylene]methanamine represents a class of compounds that can be explored for their chemical properties and biological significance.
Formula:C8H8ClN
InChI:InChI=1/C8H8ClN/c9-8-3-1-7(2-4-8)5-6-10/h1-6H,10H2/b6-5+
Synonyms:- p-Chlorobenzylidene methylamine
- (E)-2-(4-chlorophenyl)ethenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
