CAS 13114-73-3
:N,N-Diethyl-N′,N′-diphenylurea
Description:
N,N-Diethyl-N′,N′-diphenylurea, with the CAS number 13114-73-3, is an organic compound belonging to the class of ureas. It is characterized by its structure, which features two ethyl groups and two phenyl groups attached to a central urea moiety. This compound typically appears as a white to off-white crystalline solid and is known for its relatively low solubility in water, while being more soluble in organic solvents such as ethanol and acetone. N,N-Diethyl-N′,N′-diphenylurea exhibits properties that make it useful in various applications, including as a reagent in organic synthesis and potentially in agricultural chemistry. Its chemical stability and ability to form hydrogen bonds contribute to its functionality in different chemical environments. Additionally, it may exhibit biological activity, which warrants careful handling and consideration of safety protocols during use. As with many chemical substances, proper storage and disposal methods should be followed to mitigate any environmental impact.
Formula:C17H20N2O
InChI:InChI=1S/C17H20N2O/c1-3-18(4-2)17(20)19(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3
InChI key:InChIKey=DQYDFMBXYUTXOK-UHFFFAOYSA-N
SMILES:N(C(N(CC)CC)=O)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- N,N-Diethyl-N′,N′-diphenylurea
- Urea, 1,1-diethyl-3,3-diphenyl-
- Urea, N,N-diethyl-N′,N′-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
