CAS 13114-89-1

N-(2-Fluorophenyl)-N′-phenylurea

Description:

N-(2-Fluorophenyl)-N′-phenylurea, with the CAS number 13114-89-1, is a chemical compound that belongs to the class of ureas, which are characterized by the presence of the functional group -NH2CO-. This compound features a fluorinated aromatic ring, specifically a 2-fluorophenyl group, which can influence its chemical reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the fluorine atom can enhance lipophilicity and potentially alter the compound's pharmacokinetic properties. N-(2-Fluorophenyl)-N′-phenylurea has been studied for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to interact with biological systems. Its specific characteristics, such as melting point, boiling point, and spectral data, can vary based on purity and environmental conditions. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance.

Formula: C₁₃H₁₁FN₂O

InChI: InChI=1S/C13H11FN2O/c14-11-8-4-5-9-12(11)16-13(17)15-10-6-2-1-3-7-10/h1-9H,(H2,15,16,17)

InChI key: InChIKey=RHYFYHWIDOXPHK-UHFFFAOYSA-N

SMILES: N(C(NC1=CC=CC=C1)=O)C2=C(F)C=CC=C2

Synonyms:

• Carbanilide, 2-fluoro-
• N-(2-Fluorophenyl)-N′-phenylurea
• NSC 151021
• urea, N-(2-fluorophenyl)-N'-phenyl-
• 1-(2-Fluorophenyl)-3-phenylurea

Urea, N-(2-fluorophenyl)-N'-phenyl-

CAS: 13114-89-1

Formula: C₁₃H₁₁FN₂O

Molecular weight: 230.2376

Ref: IN-DA000VM7