CAS 131142-10-4: 2-[[5-[(2-Methylphenoxy)methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid
Description:2-[[5-[(2-Methylphenoxy)methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid, with CAS number 131142-10-4, is a chemical compound that belongs to the class of triazole derivatives. It features a complex structure characterized by the presence of a triazole ring, a thioether linkage, and an acetic acid functional group. This compound exhibits potential biological activity, often investigated for its role in agricultural applications, particularly as a fungicide or herbicide. Its molecular structure suggests that it may interact with specific biological targets, influencing metabolic pathways in plants or fungi. The presence of the 2-methylphenoxy group enhances its lipophilicity, potentially affecting its absorption and distribution in biological systems. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions, making it important to consider these factors in practical applications. Overall, this compound exemplifies the intricate relationship between chemical structure and biological function, highlighting its significance in both research and application contexts.
Formula:C18H17N3O3S
InChI:InChI=1S/C18H17N3O3S/c1-13-7-5-6-10-15(13)24-11-16-19-20-18(25-12-17(22)23)21(16)14-8-3-2-4-9-14/h2-10H,11-12H2,1H3,(H,22,23)
InChI key:InChIKey=PJCHXSIPRHAODA-UHFFFAOYSA-N
SMILES:O=C(O)CSC1=NN=C(N1C=2C=CC=CC2)COC=3C=CC=CC3C
- Synonyms:
- 2-[[5-[(2-Methylphenoxy)methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid
- ([5-[(2-Methylphenoxy)methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio)acetic acid
- Acetic acid, [[5-[(2-methylphenoxy)methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]-
- Acetic acid, 2-[[5-[(2-methylphenoxy)methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]-
- 2-([5-[(2-Methylphenoxy)methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl)acetic acid

2-{[5-(2-methylphenoxymethyl)-4-phenyl-4h-1,2,4-triazol-3-yl]sulfanyl}acetic acid
Ref: 54-OR84259
100mg | 209.00 € | ||
250mg | 336.00 € |

2-{[5-(2-methylphenoxymethyl)-4-phenyl-4h-1,2,4-triazol-3-yl]sulfanyl}acetic acid
Ref: 10-F644005
100mg | To inquire | ||
250mg | To inquire |

2-{[5-(2-Methylphenoxymethyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetic acid
Ref: 3D-GFA14210
1g | Discontinued | Request information | |
100mg | Discontinued | Request information |