CAS 13115-21-4
:Hydroxyguanidine
Description:
Hydroxyguanidine is an organic compound characterized by its guanidine structure, which features a hydroxyl group (-OH) attached to one of the nitrogen atoms. It is a white crystalline solid that is soluble in water and exhibits basic properties due to the presence of amino groups. Hydroxyguanidine is known for its role as a reducing agent and has applications in various fields, including medicinal chemistry and biochemistry. It has been studied for its potential therapeutic effects, particularly in the treatment of certain diseases, such as diabetes and cancer, due to its ability to modulate nitric oxide production and influence cellular signaling pathways. The compound can also participate in various chemical reactions, including the formation of hydrazones and other derivatives. However, safety considerations are important, as hydroxyguanidine can be toxic in certain concentrations, necessitating careful handling in laboratory settings. Overall, hydroxyguanidine is a versatile compound with significant implications in both research and potential therapeutic applications.
Formula:CH5N3O
InChI:InChI=1S/CH5N3O/c2-1(3)4-5/h5H,(H4,2,3,4)
InChI key:InChIKey=WFBHRSAKANVBKH-UHFFFAOYSA-N
SMILES:C(NO)(=N)N
Synonyms:- 1-Hydroxyguanidine
- 2-Hydroxyguanidine
- Guanidine, hydroxy-
- Guanidine,hydroxy- (6CI,7CI,8CI,9CI)
- Hydroxyguanidine
- N-Hydroxyguanidine
- Nsc 529357
- Urea, oxime
- Guanidine, N-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
