CAS 13115-24-7
:N-methyl acetohydroxamic acid
Description:
N-methyl acetohydroxamic acid is an organic compound characterized by its hydroxamic acid functional group, which is known for its ability to chelate metal ions and inhibit certain enzymes. This compound features a methyl group attached to the nitrogen of the hydroxamic acid, enhancing its solubility and reactivity. It typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols. N-methyl acetohydroxamic acid is often studied for its potential applications in medicinal chemistry, particularly as a lead compound in the development of pharmaceuticals targeting various diseases, including cancer and infections. Its structure allows for interactions with biological targets, making it a subject of interest in drug design. Additionally, it may exhibit properties such as antimicrobial and antifungal activities, contributing to its relevance in biochemistry and pharmacology. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C3H7NO2
InChI:InChI=1/C3H7NO2/c1-3(5)4(2)6/h6H,1-2H3
Synonyms:- Acetamide, N-hydroxy-N-methyl- (9CI)
- N-Methyl acetohydroxamic acid
- N-Hydroxy-N-methylacetamide
- N-Acetyl-N-methylhydroxylamine
- AI3-61934
- NSC 329234
- Acetohydroxamic acid, N-methyl-
- N-Methylacetohydroxamic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
