CAS 13115-28-1
:3-Nitro-2-naphthalenamine
Description:
3-Nitro-2-naphthalenamine, with the CAS number 13115-28-1, is an organic compound characterized by the presence of a naphthalene ring substituted with an amino group and a nitro group. This compound typically appears as a solid and is known for its aromatic properties due to the naphthalene structure. The nitro group introduces significant polarity, affecting its solubility and reactivity. It is generally soluble in organic solvents but may have limited solubility in water. 3-Nitro-2-naphthalenamine can participate in various chemical reactions, including electrophilic aromatic substitution and reduction processes, making it useful in synthetic organic chemistry. Additionally, it may exhibit biological activity, which can be of interest in pharmaceutical research. Safety considerations are important, as nitro compounds can be hazardous, and appropriate handling and disposal measures should be followed. Overall, this compound serves as a valuable intermediate in the synthesis of dyes, pigments, and other organic materials.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12(13)14/h1-6H,11H2
InChI key:InChIKey=ZAXOISFBCDOZER-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC2=C(C=C1N)C=CC=C2
Synonyms:- 2-Naphthylamine, 3-nitro-
- 3-Nitro-2-naphthalenamine
- 2-Naphthalenamine, 3-nitro-
- 2-Amino-3-nitronaphthalene
- 3-Nitro-2-aminonaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
