
CAS 1311569-69-3
:1-(Pentylsulfonyl)piperazine
Description:
1-(Pentylsulfonyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine featuring two nitrogen atoms. The compound is distinguished by the presence of a pentylsulfonyl group, which contributes to its unique chemical properties. This sulfonyl group enhances the compound's solubility in polar solvents and may influence its biological activity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperazine moiety's known role in various drug designs. Additionally, the presence of the pentyl chain may affect the compound's lipophilicity, impacting its pharmacokinetics and interaction with biological targets. As with many sulfonyl-containing compounds, 1-(Pentylsulfonyl)piperazine may exhibit interesting reactivity patterns, making it a subject of interest for further research in synthetic and medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C9H20N2O2S
InChI:InChI=1S/C9H20N2O2S/c1-2-3-4-9-14(12,13)11-7-5-10-6-8-11/h10H,2-9H2,1H3
InChI key:InChIKey=PCBSNHBZMQAWQW-UHFFFAOYSA-N
SMILES:S(CCCCC)(=O)(=O)N1CCNCC1
Synonyms:- 1-(Pentylsulfonyl)piperazine
- Piperazine, 1-(pentylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.