CAS 131159-39-2
:Fullerenes - C60/C70 mixture (Contains 20% C70 and 1% higher fullerenes)
Description:
Fullerenes, particularly the C60 and C70 variants, are unique carbon allotropes characterized by their spherical or cylindrical structures, resembling hollow spheres or tubes. The C60 molecule, often referred to as buckminsterfullerene, consists of 60 carbon atoms arranged in a pattern of hexagons and pentagons, while C70 has a more elongated shape with 70 carbon atoms. The mixture containing 20% C70 and a small percentage of higher fullerenes exhibits distinct physical and chemical properties, such as high stability, unique electronic characteristics, and the ability to form various derivatives. These fullerenes are known for their potential applications in nanotechnology, materials science, and medicine, including drug delivery systems and photovoltaic devices. They are also recognized for their ability to act as electron acceptors in organic photovoltaic cells. The CAS number 131159-39-2 specifically identifies this mixture, which is typically produced through the vaporization of carbon in an inert atmosphere. Overall, fullerenes represent a fascinating area of study due to their unique structure and diverse applications.
Formula:C60
InChI:InChI=1/C60/c1-2-5-6-3(1)8-12-10-4(1)9-11-7(2)17-21-13(5)23-24-14(6)22-18(8)28-20(12)30-26-16(10)15(9)25-29-19(11)27(17)37-41-31(21)33(23)43-44-34(24)32(22)42-38(28)48-40(30)46-36(26)35(25)45-39(29)47(37)55-49(41)51(43)57-52(44)50(42)56(48)59-54(46)53(45)58(55)60(57)59
SMILES:c12c3c4c5c1c1c6c7c2c2c8c3c3c9c4c4c%10c5c5c1c1c6c6c%11c7c2c2c7c8c3c3c8c9c4c4c9c%10c5c5c1c1c6c6c%11c2c2c7c3c3c8c4c4c9c5c1c1c6c2c3c41
Synonyms:- Fullerite
- Fullerenes, C60/C70 mixture
- Buckminsterfullerene, C_6_0/C_7_0~Fullerite
- Buckminsterfullerene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Fullerene powder, mixed refined, typically 70% C{60}, 28% C{70}, higher 2%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciPurity:70%Fullerenes - C₆₀/C₇₀ mixture (contains ~20% C₇₀ and ~1% higher fullerenes)
CAS:Fullerenes - C60/C70 mixture (contains ~20% C70 and ~1% higher fullerenes)
Formula:C60C70Color and Shape:black pwdr.Molecular weight:720.66, 840.77Fullerene carbon soot (contains 5-8wt% C₆₀/C₇₀ and higher fullerenes)
CAS:Fullerene carbon soot (contains 5-8wt% C60/C70 and higher fullerenes)
Formula:C60C70Color and Shape:black pwdr.Molecular weight:1560.0



