CAS 131166-87-5
:3-bromo-2,7,8-trichlorodibenzo[b,d]furan
Description:
3-Bromo-2,7,8-trichlorodibenzo[b,d]furan is a complex organic compound characterized by its polycyclic structure, which consists of fused benzene rings and a furan moiety. The presence of multiple halogen substituents, specifically three chlorine atoms and one bromine atom, significantly influences its chemical properties, including its reactivity and stability. This compound is typically classified as a halogenated aromatic compound, which may exhibit persistent environmental behavior and potential bioaccumulation. Its molecular structure suggests that it may have applications in various fields, including materials science and environmental studies, particularly in the context of studying halogenated organic pollutants. The compound's synthesis and degradation pathways are of interest due to the implications of halogenated compounds in environmental chemistry and toxicology. Additionally, the presence of halogens can affect the compound's physical properties, such as solubility and melting point, as well as its interaction with biological systems. Overall, 3-bromo-2,7,8-trichlorodibenzo[b,d]furan is a notable example of a halogenated polycyclic aromatic compound with significant implications for environmental health and safety.
Formula:C12H4BrCl3O
InChI:InChI=1/C12H4BrCl3O/c13-7-3-11-5(1-8(7)14)6-2-9(15)10(16)4-12(6)17-11/h1-4H
SMILES:c1c2c3cc(c(cc3oc2cc(c1Cl)Br)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.