CAS 131172-59-3
:5-(4-Methylphenyl)-1H-pyrrole-2-carboxylic acid
Description:
5-(4-Methylphenyl)-1H-pyrrole-2-carboxylic acid, with the CAS number 131172-59-3, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a carboxylic acid functional group (-COOH) at the 2-position of the pyrrole ring, contributing to its acidic properties. The presence of a 4-methylphenyl group at the 5-position enhances its hydrophobic characteristics and may influence its biological activity. The molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or analgesic properties. Additionally, the compound's solubility and reactivity can be affected by the substituents on the pyrrole ring, making it a subject of interest in synthetic organic chemistry. Its unique structure allows for various chemical modifications, which can lead to the synthesis of derivatives with tailored properties for specific applications in medicinal chemistry or materials science.
Formula:C12H11NO2
InChI:InChI=1/C12H11NO2/c1-8-2-4-9(5-3-8)10-6-7-11(13-10)12(14)15/h2-7,13H,1H3,(H,14,15)/p-1
InChI key:InChIKey=GUGAOFSHCGOMMW-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1NC(=CC1)C2=CC=C(C)C=C2
Synonyms:- 1H-Pyrrole-2-carboxylic acid, 5-(4-methylphenyl)-
- 5-(4-Methylphenyl)-1H-pyrrole-2-carboxylic acid
- 5-(4-methylphenyl)-1H-pyrrole-2-carboxylate
- 5-(p-Tolyl)-1H-pyrrole-2-carboxylic acid
- Timtec-Bb Sbb000400
- 5-P-TOLYL-1 H-PYRROLE-2-CARBOXYLIC ACID
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
