
CAS 131172-67-3
:1-Ethenyl-5-(4-ethylphenyl)-1H-pyrrole-2-carboxylic acid
Description:
1-Ethenyl-5-(4-ethylphenyl)-1H-pyrrole-2-carboxylic acid, identified by its CAS number 131172-67-3, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a vinyl group (1-ethenyl) and a carboxylic acid functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the 4-ethylphenyl substituent enhances its hydrophobic characteristics and may influence its solubility in various solvents. The carboxylic acid group imparts acidic properties, allowing for potential interactions in biochemical systems or as a precursor in chemical reactions. The compound's unique structure may also confer specific optical or electronic properties, making it of interest in materials science and medicinal chemistry. Overall, its distinct functional groups and structural features suggest potential utility in various chemical applications, including drug development and polymer chemistry.
Formula:C15H15NO2
InChI:InChI=1S/C15H15NO2/c1-3-11-5-7-12(8-6-11)13-9-10-14(15(17)18)16(13)4-2/h4-10H,2-3H2,1H3,(H,17,18)
InChI key:InChIKey=JCKJXCLFXLNOFD-UHFFFAOYSA-N
SMILES:C(=C)N1C(=CC=C1C(O)=O)C2=CC=C(CC)C=C2
Synonyms:- 1-Ethenyl-5-(4-ethylphenyl)-1H-pyrrole-2-carboxylic acid
- 1H-Pyrrole-2-carboxylic acid, 1-ethenyl-5-(4-ethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(4-Ethylphenyl)-1-vinyl-1H-pyrrole-2-carboxylic acid
CAS:Formula:C15H15NO2Molecular weight:241.2851
