
CAS 131172-70-8
:1-Ethenyl-4-ethyl-5-phenyl-1H-pyrrole-2-carboxylic acid
Description:
1-Ethenyl-4-ethyl-5-phenyl-1H-pyrrole-2-carboxylic acid, with the CAS number 131172-70-8, is a chemical compound that belongs to the pyrrole family, characterized by a five-membered aromatic ring containing nitrogen. This compound features a vinyl group (1-ethenyl) and various substituents, including an ethyl group and a phenyl group, which contribute to its unique chemical properties. The presence of a carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in different solvents. The structural complexity of this compound suggests potential applications in organic synthesis, pharmaceuticals, or materials science. Its reactivity may be influenced by the electron-donating and withdrawing effects of the substituents, which can affect its stability and interaction with other chemical species. Overall, this compound represents a diverse area of study within organic chemistry, particularly in the context of functionalized heterocycles.
Formula:C15H15NO2
InChI:InChI=1S/C15H15NO2/c1-3-11-10-13(15(17)18)16(4-2)14(11)12-8-6-5-7-9-12/h4-10H,2-3H2,1H3,(H,17,18)
InChI key:InChIKey=FLAXOPKZWSUVJN-UHFFFAOYSA-N
SMILES:C(=C)N1C(=C(CC)C=C1C(O)=O)C2=CC=CC=C2
Synonyms:- 1-Ethenyl-4-ethyl-5-phenyl-1H-pyrrole-2-carboxylic acid
- 1H-Pyrrole-2-carboxylic acid, 1-ethenyl-4-ethyl-5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
