CAS 131176-02-8
:(2R,4S)-4-fluoropyrrolidine-2-carboxylic acid
Description:
(2R,4S)-4-fluoropyrrolidine-2-carboxylic acid is a chiral compound characterized by its pyrrolidine ring structure, which contains a fluorine atom at the 4-position and a carboxylic acid functional group at the 2-position. This compound exhibits stereochemistry, with specific configurations at the 2 and 4 positions, contributing to its potential biological activity and interactions. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The fluorine substitution can enhance lipophilicity and influence the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the chirality of the molecule may affect its binding affinity and selectivity for biological targets, which is crucial in drug design. Overall, (2R,4S)-4-fluoropyrrolidine-2-carboxylic acid is a compound of interest in both synthetic and pharmaceutical chemistry due to its unique structural features and potential applications.
Formula:C5H8FNO2
InChI:InChI=1/C5H8FNO2/c6-3-1-4(5(8)9)7-2-3/h3-4,7H,1-2H2,(H,8,9)/t3-,4+/m0/s1
Synonyms:- (2R,4S)-4-Fluoro-2-pyrrolidinecarboxylic acid
- (4S)-4-Fluor-D-prolin
- (4S)-4-Fluoro-D-proline
- D-proline, 4-fluoro-, (4S)-
- (2R,4S)-4-fluoropyrrolidinium-2-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Trans-4-fluoropyrrolidine-2-carboxylic acid hcl
CAS:Formula:C5H8FNO2Purity:97%Molecular weight:133.1209(2R,4S)-4-Fluoropyrrolidine-2-carboxylic acid
CAS:<p>(2R,4S)-4-Fluoropyrrolidine-2-carboxylic acid</p>Purity:≥95%Molecular weight:133.12g/mol(2R,4S)-4-Fluoropyrrolidine-2-carboxylic acid
CAS:Formula:C5H8FNO2Purity:97%Color and Shape:SolidMolecular weight:133.122(2R,4S)-4-Fluoropyrrolidine-2-carboxylic acid
CAS:<p>Please enquire for more information about (2R,4S)-4-Fluoropyrrolidine-2-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C5H8FNO2Purity:Min. 95%Molecular weight:133.12 g/mol



