CymitQuimica logo

CAS 131179-08-3

:

methyl 7-azabicyclo[2.2.1]heptane-7-carboxylate

Description:
Methyl 7-azabicyclo[2.2.1]heptane-7-carboxylate is a bicyclic compound characterized by its unique structure, which includes a nitrogen atom incorporated into a bicyclic framework. This compound features a carboxylate functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. The bicyclic structure provides rigidity, which can influence the compound's biological activity and interaction with other molecules. Additionally, the azabicyclic framework may impart interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its CAS number, 131179-08-3, allows for precise identification in chemical databases and literature. Overall, methyl 7-azabicyclo[2.2.1]heptane-7-carboxylate is notable for its structural features and potential utility in synthetic and medicinal chemistry applications.
Formula:C8H13NO2
InChI:InChI=1/C8H13NO2/c1-11-8(10)9-6-2-3-7(9)5-4-6/h6-7H,2-5H2,1H3
Synonyms:
  • 7-Azabicyclo(2.2.1)heptane-7-carboxylic acid, methyl ester
  • 7-Azabicyclo[2.2.1]heptane-7-carboxylic acid, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.