CAS 131179-77-6
:N-(3,5-DIMETHYLPHENYL)-2-(4-HYDROXYPHENYL)ACETAMIDE
Description:
N-(3,5-Dimethylphenyl)-2-(4-hydroxyphenyl)acetamide, with the CAS number 131179-77-6, is an organic compound characterized by its amide functional group, which is derived from acetic acid and an aromatic structure. This compound features a dimethyl-substituted phenyl group and a hydroxyphenyl group, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of hydroxyl groups suggests potential for hydrogen bonding, which can influence its reactivity and interaction with biological targets. This compound may be of interest in pharmaceutical research due to its structural features, which could impart specific pharmacological properties. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C16H17NO2
InChI:InChI=1/C16H17NO2/c1-11-7-12(2)9-14(8-11)17-16(19)10-13-3-5-15(18)6-4-13/h3-9,18H,10H2,1-2H3,(H,17,19)
SMILES:Cc1cc(C)cc(c1)N=C(Cc1ccc(cc1)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-(3,5-Dimethylphenyl)-2-(4-hydroxyphenyl)acetamide
CAS:Formula:C16H17NO2Color and Shape:SolidMolecular weight:255.3117N-(3,5-Dimethylphenyl)-2-(4-hydroxyphenyl)acetamide
CAS:Controlled ProductApplications Efaproxiral intermediate.
References Youssef, A., et al.: J. Med. Chem., 45, 1184 (2002),Formula:C16H17NO2Color and Shape:NeatMolecular weight:255.31
