CAS 131179-95-8
:Efaproxiral
Description:
Efaproxiral, also known by its chemical name RSR13, is a synthetic compound primarily studied for its potential use in enhancing the efficacy of radiotherapy in cancer treatment. It functions as a hemoglobin modifier, specifically designed to reduce the oxygen affinity of hemoglobin, thereby increasing the availability of oxygen to hypoxic tumor tissues. This mechanism is crucial because many tumors exhibit low oxygen levels, which can lead to resistance against radiation therapy. Efaproxiral is characterized by its ability to improve tumor oxygenation, potentially leading to improved therapeutic outcomes. The compound has a molecular formula that reflects its complex structure, and it is typically administered intravenously. Its pharmacokinetics involve rapid distribution and elimination, which are important for its therapeutic application. While efaproxiral has shown promise in clinical trials, its use is subject to ongoing research to fully understand its efficacy and safety profile in various cancer types.
Formula:C20H23NO4
InChI:InChI=1S/C20H23NO4/c1-13-9-14(2)11-16(10-13)21-18(22)12-15-5-7-17(8-6-15)25-20(3,4)19(23)24/h5-11H,12H2,1-4H3,(H,21,22)(H,23,24)
InChI key:InChIKey=BNFRJXLZYUTIII-UHFFFAOYSA-N
SMILES:O(C(C(O)=O)(C)C)C1=CC=C(CC(NC2=CC(C)=CC(C)=C2)=O)C=C1
Synonyms:- 2-(4-(((3,5-Dimethylanilino)Carbonyl)Methyl)Phenoxy)-2-Methylpropionic Acid
- 2-(4-{2-[(3,5-Dimethylphenyl)Amino]-2-Oxoethyl}Phenoxy)-2-Methylpropanoic Acid
- 2-[4-(3,5-Dimethylphenylcarbamoylmethyl)phenoxy]-2-methylpropionic acid
- 2-[4-[[[(3,5-Dimethylphenyl)amino]carbonyl]methyl]phenoxy]-2-methylpropionic acid
- Propanoic acid, 2-[4-[2-[(3,5-dimethylphenyl)amino]-2-oxoethyl]phenoxy]-2-methyl-
- Rsr 13
- Efaproxiral
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Propanoic acid, 2-[4-[2-[(3,5-dimethylphenyl)amino]-2-oxoethyl]phenoxy]-2-methyl-
CAS:Formula:C20H23NO4Purity:95%Color and Shape:SolidMolecular weight:341.4009Efaproxiral
CAS:Controlled ProductApplications Allosteric modifier of hemoglobin (HB). Binds in the central water cavity of the Hb molecule causing a conformational change such that bound oxygen is released more readily. Antineoplastic adjunct (radiosensitizer).
References Abraham, D.J., et al.: Biochemistry, 31, 9141 (1992), Pagel, P.S., et al.: J. Pharmacol. Exp. Ther., 285, 1 (1998), Kleinberg, L., et al.: J. Clin. Oncol., 17, 2593 (1999),Formula:C20H23NO4Color and Shape:NeatMolecular weight:341.4Efaproxiral
CAS:Efaproxiral (RSR13) is a hemoglobin allosteric modulator, a potential radiation sensitizer and chemotherapy enhancer, improving tumor oxygenation.Formula:C20H23NO4Purity:98.98%Color and Shape:SolidMolecular weight:341.4Efaproxiral
CAS:Controlled ProductHaemoglobin (Hb) synthetic allosteric modifierFormula:C20H23NO4Purity:Min. 95%Molecular weight:341.4 g/mol




