CAS 13118-10-0
:1-Methyl-3-(a-cyclopentylmandeloyloxy)pyrrolidinehydrochloride
Description:
1-Methyl-3-(α-cyclopentylmandeloyloxy)pyrrolidine hydrochloride, with the CAS number 13118-10-0, is a chemical compound that belongs to the class of pyrrolidine derivatives. This substance features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, substituted with a methyl group and an α-cyclopentylmandeloyloxy moiety. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in water and stability. The compound may exhibit biological activity, potentially influencing neurotransmitter systems, given the structural similarities to other psychoactive substances. Its specific pharmacological properties, such as efficacy and safety profile, would require further investigation through experimental studies. Additionally, the compound's synthesis, characterization, and potential applications in medicinal chemistry or drug development could be of interest to researchers in the field. As with any chemical substance, proper handling and safety protocols should be observed due to potential hazards associated with its use.
Formula:C18H25NO3
InChI:InChI=1/C18H25NO3/c1-19-12-11-16(13-19)22-17(20)18(21,15-9-5-6-10-15)14-7-3-2-4-8-14/h2-4,7-8,15-16,21H,5-6,9-13H2,1H3
SMILES:CN1CCC(C1)OC(=O)C(c1ccccc1)(C1CCCC1)O
Synonyms:- ahr 376 alpha-cyclopentylmandelic acid 1-methyl-3-pyrrolidinyl ester hydrochloride mandelic acid, alpha-cyclopentyl-,1-methyl-3-pyrrolidinyl ester, hydrochloride 1-Methyl-3-(-cyclopentylmandeloyloxy)pyrrolidine hydrochloride 1-Methyl-3-pyrrolidinyl -cyclopentylmandelate hydrochloride
- Mandelic Acid, Alpha-Cyclopentyl-, 1-Methyl-3-Pyrrolidinyl Ester, Hydrochloride 1-Methyl-3-Pyrrolidyl Alpha-Phenylcyclopentaneglycolate Hydrochloride
- 3-{[Cyclopentyl(Hydroxy)Phenylacetyl]Oxy}-1-Methylpyrrolidinium Chloride
- 1-Methylpyrrolidin-3-Yl Cyclopentyl(Hydroxy)Phenylacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Glycopyrrolate Related Compound B (1-Methylpyrrolidin-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate Hydrochloride)
CAS:Aromatic polycarboxylic acids, their anhydrides, halideFormula:C18H25NO3Color and Shape:Off-White PowderMolecular weight:303.183441-Methylpyrrolidin-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate hydrochloride
CAS:Formula:C18H26ClNO3Purity:95%Color and Shape:SolidMolecular weight:339.85694000000011-Methylpyrrolidin-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate hydrochloride
CAS:1-Methylpyrrolidin-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate hydrochloridePurity:95%Molecular weight:339.86g/mol1-Methylpyrrolidin-3-yl 2-Cyclopentyl-2-hydroxy-2-phenylacetate Hydrochloride
CAS:Color and Shape:NeatGlycopyrrolate related B
CAS:Controlled ProductGlycopyrrolate related B is a drug product that belongs to the class of drugs for research and development. It is a natural metabolite of glycopyrrolate and is used as an analytical standard. The metabolite can also be used as a synthetic intermediate or impurity standard in pharmaceutical production. It has been shown that glycopyrrolate related B has niche applications in drug development and metabolism studies. Glycopyrrolate related B is not found in the pharmacopeia, but it can be synthesized by reacting the corresponding amine with pyrrole-2-carboxaldehyde.Formula:C18H26ClNO3Purity:Min. 95%Molecular weight:339.9 g/mol






