CymitQuimica logo

CAS 13118-70-2

:

bicyclo[2.2.1]hept-2-en-7-ol

Description:
Bicyclo[2.2.1]hept-2-en-7-ol, with the CAS number 13118-70-2, is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclic framework with a double bond and a hydroxyl (-OH) group. This compound features a seven-membered ring system that includes two bridged carbon atoms, contributing to its rigidity and distinct stereochemistry. The presence of the double bond at the 2-position and the hydroxyl group at the 7-position imparts specific reactivity and solubility properties, making it a valuable intermediate in organic synthesis. Bicyclo[2.2.1]hept-2-en-7-ol is typically colorless to pale yellow in appearance and may exhibit a characteristic odor. Its chemical properties include potential participation in various reactions such as oxidation, reduction, and substitution, which are common for alcohols and alkenes. The compound's unique structure and functional groups make it of interest in fields such as medicinal chemistry and materials science, where it can be utilized in the development of novel compounds and applications.
Formula:C7H10O
InChI:InChI=1/C7H10O/c8-7-5-1-2-6(7)4-3-5/h1-2,5-8H,3-4H2
SMILES:C1=CC2CCC1C2O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.