
CAS 131180-59-1
:(2S)-α,α-Bis(3-chlorophenyl)-2-pyrrolidinemethanol
Description:
(2S)-α,α-Bis(3-chlorophenyl)-2-pyrrolidinemethanol is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with two 3-chlorophenyl groups, indicating the presence of chlorine atoms on the phenyl rings. The compound also contains a hydroxymethyl group (-CH2OH) attached to the pyrrolidine, contributing to its potential reactivity and solubility in polar solvents. The stereochemistry, denoted by the (2S) configuration, suggests that the compound exhibits chirality, which can influence its biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological properties. Its CAS number, 131180-59-1, allows for precise identification in chemical databases and literature. Overall, the unique combination of its functional groups and stereochemistry makes it a subject of interest for further research and application in various chemical and pharmaceutical contexts.
Formula:C17H17Cl2NO
InChI:InChI=1S/C17H17Cl2NO/c18-14-6-1-4-12(10-14)17(21,16-8-3-9-20-16)13-5-2-7-15(19)11-13/h1-2,4-7,10-11,16,20-21H,3,8-9H2/t16-/m0/s1
InChI key:InChIKey=SBPHQJFBMFPILN-INIZCTEOSA-N
SMILES:[C@](O)(C1=CC(Cl)=CC=C1)(C2=CC(Cl)=CC=C2)[C@@H]3CCCN3
Synonyms:- 2-Pyrrolidinemethanol, α,α-bis(3-chlorophenyl)-, (S)-
- 2-Pyrrolidinemethanol, α,α-bis(3-chlorophenyl)-, (2S)-
- (2S)-α,α-Bis(3-chlorophenyl)-2-pyrrolidinemethanol
- 2-Pyrrolidinemethanol α,α-bis(3-chlorophenyl)-, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.