CAS 131180-90-0

(S)-Tetrahydro-1,3,3-triphenyl-1H,3H-pyrrolo[1,2-c][1,3,2]oxaborole

Description:

(S)-Tetrahydro-1,3,3-triphenyl-1H,3H-pyrrolo[1,2-c][1,3,2]oxaborole is a complex organic compound characterized by its unique bicyclic structure that incorporates both a pyrrole and a boron-containing moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and is further substituted with three phenyl groups, which contribute to its hydrophobic character and potential for π-π stacking interactions. The presence of the boron atom in the oxaborole structure is significant, as it can participate in coordination chemistry and may enhance the compound's reactivity and stability. The stereochemistry of the compound is denoted by the (S) configuration, indicating a specific spatial arrangement of its substituents, which can influence its biological activity and interactions. This compound has garnered interest in medicinal chemistry, particularly for its potential applications in drug development and as a tool in biological research, owing to its unique structural features and reactivity profile.

Formula: C₂₃H₂₂BNO

InChI: InChI=1S/C23H22BNO/c1-4-11-19(12-5-1)23(20-13-6-2-7-14-20)22-17-10-18-25(22)24(26-23)21-15-8-3-9-16-21/h1-9,11-16,22H,10,17-18H2/t22-/m0/s1

SMILES: c1ccc(cc1)C1(c2ccccc2)[C@@H]2CCCN2B(c2ccccc2)O1

Synonyms:

• (3aS)-1,3,3-Triphenyltetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaborole

(S)-1,3,3-Triphenylhexahydropyrrolo[1,2-c][1,3,2]oxazaborole

CAS: 131180-90-0

Formula: C₂₃H₂₂BNO

Molecular weight: 339.2379

Ref: IN-DA000VO8