CAS 13119-77-2
:Ethyl α-oxo-4-quinolinepropanoate
Description:
Ethyl α-oxo-4-quinolinepropanoate, with the CAS number 13119-77-2, is a chemical compound that belongs to the class of quinoline derivatives. It typically exhibits a yellow to brownish color and is characterized by its unique structure, which includes a quinoline ring fused with a propanoate moiety. This compound is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. Ethyl α-oxo-4-quinolinepropanoate may possess properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects can vary based on structural modifications and the presence of substituents. It is generally soluble in organic solvents, and its reactivity can be influenced by the functional groups present in its structure. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Proper storage and disposal methods are essential to ensure safety in laboratory settings.
Formula:C14H13NO3
InChI:InChI=1S/C14H13NO3/c1-2-18-14(17)13(16)9-10-7-8-15-12-6-4-3-5-11(10)12/h3-8H,2,9H2,1H3
InChI key:InChIKey=LXXAVQCSCMLSAP-UHFFFAOYSA-N
SMILES:C(C(C(OCC)=O)=O)C=1C2=C(N=CC1)C=CC=C2
Synonyms:- Ethyl α-oxo-4-quinolinepropanoate
- 4-Quinolinepyruvic acid, ethyl ester
- 4-Quinolinepropanoic acid, α-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
