
CAS 13120-40-6
:2-Oxo-2-[(2-thienylmethyl)amino]acetic acid
Description:
2-Oxo-2-[(2-thienylmethyl)amino]acetic acid, with the CAS number 13120-40-6, is an organic compound characterized by its unique structure that includes a thienylmethyl group attached to an amino acid backbone. This compound features a keto group (2-oxo) and an amino group, which contribute to its reactivity and potential biological activity. The presence of the thienyl ring, a five-membered aromatic heterocycle containing sulfur, imparts specific electronic properties and can influence the compound's interactions with biological targets. Typically, compounds of this nature may exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and potential applications in medicinal chemistry due to their ability to mimic natural amino acids. The structural characteristics suggest that it may participate in various chemical reactions, including acylation and amination, and could serve as a precursor for synthesizing more complex molecules. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications in drug development.
Formula:C7H7NO3S
InChI:InChI=1S/C7H7NO3S/c9-6(7(10)11)8-4-5-2-1-3-12-5/h1-3H,4H2,(H,8,9)(H,10,11)
InChI key:InChIKey=VRDIUJCXTZNRJX-UHFFFAOYSA-N
SMILES:C(NC(C(O)=O)=O)C1=CC=CS1
Synonyms:- Acetic acid, 2-oxo-2-[(2-thienylmethyl)amino]-
- [(Thiophen-2-ylmethyl)carbamoyl]formic acid
- 2-Oxo-2-[(2-thienylmethyl)amino]acetic acid
- Oxamic acid, (2-thenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.